ENDO-NORBORNEOL manufacturers
- ENDO-NORBORNEOL
-
- $30.00
-
2026-08-07
- CAS:497-36-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 3000KG
|
| | ENDO-NORBORNEOL Basic information |
| Product Name: | ENDO-NORBORNEOL | | Synonyms: | ENDO-NORBORNEOL;ENDO-(+/-)-2-NORBORNANOL;endo-bicyclo[2.2.1]heptan-2-ol;rel-(1α*,4α*)-Bicyclo[2.2.1]heptane-2β*-ol;endo-(±)-Norborneol,92%;endo-(±:)-Norborneol;endo-(§1)-Norborneol, 92%;rel-(1R,3R,4S)-bicyclo[2.2.1]heptan-3-ol | | CAS: | 497-36-9 | | MF: | C7H12O | | MW: | 112.17 | | EINECS: | 207-844-0 | | Product Categories: | | | Mol File: | 497-36-9.mol |  |
| | ENDO-NORBORNEOL Chemical Properties |
| Melting point | 149-151 °C(lit.) | | Boiling point | 176.5±0.0℃ (760 Torr) | | density | 1.097±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4460 (estimate) | | Fp | 74.4±10.9℃ | | pka | 15.31±0.20(Predicted) | | form | powder | | InChI | 1S/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 | | InChIKey | ZQTYQMYDIHMKQB-XVMARJQXSA-N | | SMILES | O[C@@H]1[C@H]2C[C@H](CC2)C1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29061900 | | Storage Class | 11 - Combustible Solids |
| | ENDO-NORBORNEOL Usage And Synthesis |
| Chemical Properties | light yellow-beige adhering crystals or powder |
| | ENDO-NORBORNEOL Preparation Products And Raw materials |
|