| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 1,3,5,7-Tetrakis(3,3,3-trifluoropropyl)1,3,5,7-tetramethylcyclosiloxanes Basic information |
| Product Name: | 1,3,5,7-Tetrakis(3,3,3-trifluoropropyl)1,3,5,7-tetramethylcyclosiloxanes | | Synonyms: | 1,3,5,7-Tetrakis-(3,3,3-trifluoropropyl)-1,3,5,7-tetramethylcyclosiloxane;TETRAMETHYL-3,3,3-TRIFLUOROPROPYLCYCLOTETRASILOXANE;(3,3,3-TRIFLUOROPROPYL)METHYLSILOXANE CYCLIC TETRAMER);1,3,5,7-TETRAKIS(3,3,3-TRIFLUOROPROPYL)1,3,5,7-TETRAMETHYLCYCLOSILOXANES, 95% MIN.;(3,3,3-trifluoropropyl)methylcyclotetrasiloxane;2,4,6,8-Tetramethyl-2,4,6,8-tetrakis(3,3,3-trifluoropropyl)cyclooctanetetrasiloxane;2,4,6,8-tetramethyl-2,4,6,8-tetrakis(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;1,3,5,7-TETRAKIS(3,3,3-TRIFLUOROPROPYL)1,3,5,7-TETRAMETHYLCYCLOTetraSILOXANE | | CAS: | 429-67-4 | | MF: | C16H28F12O4Si4 | | MW: | 624.71 | | EINECS: | 207-060-9 | | Product Categories: | | | Mol File: | 429-67-4.mol |  |
| | 1,3,5,7-Tetrakis(3,3,3-trifluoropropyl)1,3,5,7-tetramethylcyclosiloxanes Chemical Properties |
| Boiling point | 134 °C(Press: 3 Torr) | | density | 1.255 g/cm3(Temp: 26 °C) | | refractive index | 1.3720 | | Fp | 150 °C | | form | Liquid | | Specific Gravity | 1.2735 | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | Cosmetics Ingredients Functions | SKIN CONDITIONING HAIR CONDITIONING | | InChI | 1S/C16H28F12O4Si4/c1-33(9-5-13(17,18)19)29-34(2,10-6-14(20,21)22)31-36(4,12-8-16(26,27)28)32-35(3,30-33)11-7-15(23,24)25/h5-12H2,1-4H3 | | InChIKey | XOVNCWWRDSAYNE-UHFFFAOYSA-N | | SMILES | C[Si]1(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1 | | EPA Substance Registry System | Cyclotetrasiloxane, 2,4,6,8-tetramethyl-2,4,6,8-tetrakis(3,3,3-trifluoropropyl)- (429-67-4) |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids |
| | 1,3,5,7-Tetrakis(3,3,3-trifluoropropyl)1,3,5,7-tetramethylcyclosiloxanes Usage And Synthesis |
| reaction suitability | core: silicon reagent type: catalyst |
| | 1,3,5,7-Tetrakis(3,3,3-trifluoropropyl)1,3,5,7-tetramethylcyclosiloxanes Preparation Products And Raw materials |
|