|
|
| | 5-Chloro-8-nitroquinoline Basic information |
| | 5-Chloro-8-nitroquinoline Chemical Properties |
| Melting point | 136-136.5℃ | | Boiling point | 353.6±27.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 0.12±0.29(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C9H5ClN2O2/c10-7-3-4-8(12(13)14)9-6(7)2-1-5-11-9/h1-5H | | InChIKey | DHRPLGHWWKFRKY-UHFFFAOYSA-N | | SMILES | N1C2C(=C(Cl)C=CC=2[N+]([O-])=O)C=CC=1 |
| | 5-Chloro-8-nitroquinoline Usage And Synthesis |
| Uses | 5-Chloro-8-nitroquinoline itself is not typically used as a final product; its core value lies in its role as a pharmaceutical intermediate. Its primary use is in the synthesis of bioactive molecules, particularly antimalarial drugs. | | Reactions | 5-Chloro-8-nitroquinoline is a heterocyclic compound featuring a quinoline backbone substituted with a chlorine atom at position 5 and a nitro group at position 8 . The chlorine substituent enhances its biological activity by modulating electronic properties and binding interactions, while the nitro group contributes to its redox activity and coordination chemistry. |
| | 5-Chloro-8-nitroquinoline Preparation Products And Raw materials |
|