|
|
| | CGP 54626 HYDROCHLORIDE Basic information |
| Product Name: | CGP 54626 HYDROCHLORIDE | | Synonyms: | CGP 54626 HYDROCHLORIDE;[S-(R*,R*)]-[3-[[1-(3,4-DICHLOROPHENYL)ETHYL]AMINO]-2-HYDROXYPROPYL](CYCLOHEXYLMETHYL) PHOSPHINIC ACID HYDROCHLORIDE;(S-(R*,R*))-(3-((1-(3,4-Dichlorophenyl)ethyl)amino)-2-hydroxypropyl)-([3.4-3H]-cyclohexylmethyl)phosphinicacid;[3H]-CGP54626;CGP 54626;[S-(R*,R*)]-[3-[[1-(3,4-Dichlorophenyl)ethyl]amino]-2-hydroxypropyl](cyclohexylmethyl)phosphinic acid hydrochloride;TOC CGP 54626 Hydrochloride;[S-(R*,R*)]-[3-[[1-(3,4-Dichlorophenyl)ethyl]amino]-2-hydroxypropyl](cyclohexylmethyl)phosphinicacid | | CAS: | 149184-21-4 | | MF: | C18H27Cl2NO3PT | | MW: | 410.31 | | EINECS: | | | Product Categories: | GABA/Glycine receptor | | Mol File: | 149184-21-4.mol |  |
| | CGP 54626 HYDROCHLORIDE Chemical Properties |
| storage temp. | Store at RT | | solubility | DMF: 0.33 mg/ml; DMSO: 1 mg/ml; DMSO:PBS (pH 7.2) (1:6): 0.14 mg/ml; Ethanol: 0.2 mg/ml | | form | A crystalline solid | | color | White | | InChIKey | ZQCFHOVIXCJPLE-LINSIKMZSA-N | | SMILES | ClC1=C(C=CC([C@@H](NC[C@@H](CP(CC2CCCCC2)(O)=O)O)C)=C1)Cl.Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | CGP 54626 HYDROCHLORIDE Usage And Synthesis |
| Description | CGP 54626 is a selective antagonist of the GABAB receptor with an IC50 value of 4 nM. It can be used to investigate the role of GABAB receptors in neurological signaling. | | Uses | CGP 54626 (hydrochloride) is a selective antagonist of GABAB receptor with an IC50 value of 4 nM. CGP 54626 (hydrochloride) can be used to investigate the role of GABAB receptors in neurological signaling[1]. | | Biological Activity | A potent, selective GABA B receptor antagonist (IC 50 = 4 nM). | | storage | Room temperature | | References | [1] Kaupmann K, et al. GABA(B)-receptor subtypes assemble into functional heteromeric complexes. Nature. 1998 Dec 17;396(6712):683-7. DOI:10.1038/25360 |
| | CGP 54626 HYDROCHLORIDE Preparation Products And Raw materials |
|