| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:(R)-2-isobutyraMido-3-Mercaptopropanoic acid CAS:124529-02-8 Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
| Company Name: |
Guangzhou Isun Pharmaceutical Co., Ltd
|
| Tel: |
020-39119399 18927568969 |
| Email: |
isunpharm@qq.com |
| Products Intro: |
Product Name:N-Isobutyryl-L-cysteine CAS:124529-02-8 Purity:98% Package:1G; 5G; 25G; 100G; 1KG; 5KG
|
| Company Name: |
SINO High Goal Chemical Technology Co., Ltd.
|
| Tel: |
021-57646680 18306277365 |
| Email: |
sunkai@chembiobanksh.com |
| Products Intro: |
Product Name:N-ISOBUTYRYL-L-CYSTEINE CAS:124529-02-8 Purity:98% Package:5g;10g;15g;25g;
|
|
| | I-BUT-CYS-OH Basic information |
| Product Name: | I-BUT-CYS-OH | | Synonyms: | ISOBUTYRYL-CYS-OH;ISOBUTYRYL-L-CYSTEINE;I-BUT-CYS-OH;N-isobutyrylcysteine;(R)-N-Isobutyryl-2-(mercaptomethyl)glycine;(2R)-2-(2-methylpropanoylamino)-3-sulfanylpropanoic acid;(2R)-2-(2-methylpropanoylamino)-3-sulfanyl-propanoic acid;(2R)-2-(isobutyrylamino)-3-mercapto-propionic acid | | CAS: | 124529-02-8 | | MF: | C7H13NO3S | | MW: | 191.25 | | EINECS: | | | Product Categories: | | | Mol File: | 124529-02-8.mol |  |
| | I-BUT-CYS-OH Chemical Properties |
| Melting point | 97-101 °C | | Boiling point | 401.6±40.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.26±0.10(Predicted) | | form | solid | | InChI | 1S/C7H13NO3S/c1-4(2)6(9)8-5(3-12)7(10)11/h4-5,12H,3H2,1-2H3,(H,8,9)(H,10,11)/t5-/m0/s1 | | InChIKey | BWBQXMAXLAHHTK-YFKPBYRVSA-N | | SMILES | CC(C)C(=O)N[C@@H](CS)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10-23 | | Storage Class | 11 - Combustible Solids |
| | I-BUT-CYS-OH Usage And Synthesis |
| Uses | N-Isobutyryl-L-cysteine may be used as a chiral derivatization agent for the determination of D- and L-amino acids in natural/synthetic bioactive peptides, pharmaceutical formulations and absolute configuration of selenomethionine using chromatography techniques. | | General Description | N-Isobutyryl-L-cysteine is a chiral derivatizing agent, widely used for the separation of amino acid enantiomers. |
| | I-BUT-CYS-OH Preparation Products And Raw materials |
|