| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Tris(1H,1H,2H,2H-perfluorohexyl)tin hydride Basic information |
| Product Name: | Tris(1H,1H,2H,2H-perfluorohexyl)tin hydride | | Synonyms: | TRIS(3,3,4,4,5,5,6,6,6-NONAFLUOROHEXYL)TIN HYDRIDE;Stannane, tris(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-;Tris(1H,1H,2H,2H-perfluorohexyl)tin hydride | | CAS: | 240497-26-1 | | MF: | C18H13F27Sn | | MW: | 860.96 | | EINECS: | | | Product Categories: | | | Mol File: | 240497-26-1.mol |  |
| | Tris(1H,1H,2H,2H-perfluorohexyl)tin hydride Chemical Properties |
| Boiling point | 341.6±42.0 °C(Predicted) | | InChI | 1S/3C6H4F9.Sn.H/c3*1-2-3(7,8)4(9,10)5(11,12)6(13,14)15;;/h3*1-2H2;; | | InChIKey | IXGCTPQSODDMDJ-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[SnH](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Tris(3,3,4,4,5,5,6,6,6-nonafluorohexyl)stannane (240497-26-1) |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-50/53 | | Safety Statements | 26-28-60-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 12 - Non Combustible Liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | Tris(1H,1H,2H,2H-perfluorohexyl)tin hydride Usage And Synthesis |
| | Tris(1H,1H,2H,2H-perfluorohexyl)tin hydride Preparation Products And Raw materials |
|