| Company Name: |
Henan yingchuang Gold |
| Tel: |
16650708709 |
| Email: |
hnyingchuang@163.com |
|
| | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE Basic information |
| Product Name: | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE | | Synonyms: | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE;N-(3-(DIMETHYLAMINO)PROPYL)-N,N',N'-TRIMETHYLPROPANE-1,3-DIAMINE;N,N,N',N',N''-PENTAMETHYL DIPROPYLENE TRIAMINE;N,N,N',N'',N''-PENTAMETHYLDIPROPYLEN-TRIAMIN;N-METHYL-N,N-BIS[3-(DIMETHYLAMINO)PROPYL]AMINE;3-Propanediamine,N-[3-(dimethylamino)propyl]-N,N’,N’-trimethyl-1;N,N,N’-Trimethyl-N’-[3-(dimethylamino)propyl]-1,3-propanediamine;n-[3-(dimethylamino)propyl]-n,n’,n’-trimethyl-3-propanediamine | | CAS: | 3855-32-1 | | MF: | C11H27N3 | | MW: | 201.35 | | EINECS: | 223-362-3 | | Product Categories: | | | Mol File: | 3855-32-1.mol |  |
| | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE Chemical Properties |
| Boiling point | 102 °C / 1mmHg | | density | 0,83 g/cm3 | | vapor pressure | 2hPa at 10℃ | | refractive index | 1.4450 to 1.4480 | | Fp | 92°C | | storage temp. | 2-8°C, protect from light | | form | clear liquid | | pka | 9.88±0.28(Predicted) | | color | Colorless to Yellow to Green | | Odor | Fishy odor | | Water Solubility | 193.9g/L at 25℃ | | InChI | InChI=1S/C11H27N3/c1-12(2)8-6-10-14(5)11-7-9-13(3)4/h6-11H2,1-5H3 | | InChIKey | SKCNNQDRNPQEFU-UHFFFAOYSA-N | | SMILES | C(N(CCCN(C)C)C)CCN(C)C | | LogP | 0 at 25℃ | | CAS DataBase Reference | 3855-32-1(CAS DataBase Reference) | | EPA Substance Registry System | 1,3-Propanediamine, N-[3-(dimethylamino)propyl]-N,N',N'-trimethyl- (3855-32-1) |
| Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 1760 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29212900 |
| | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE Usage And Synthesis |
| Chemical Properties | Colorless Transparent Liquid | | Uses | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE is mainly used in the alkali fusion process to produce phenol, and also in the production of resorcinol, etc. It is often used as a catalyst in esterification and dehydration reactions; dye intermediate. |
| | 2,6,10-TRIMETHYL-2,6,10-TRIAZAUNDECANE Preparation Products And Raw materials |
|