|
|
| | 1-(2-Nitrophenoxy)acetone Basic information |
| Product Name: | 1-(2-Nitrophenoxy)acetone | | Synonyms: | 1-(2-nitrophenoxy)propan-2-one;1-(2-nitrophenoxy)acetone(SALTDATA: FREE);(2-NITROPHENOXY)-2-PROPANONE;CHEMBRDG-BB 7118831;2-Propanone, 1-(2-nitrophenoxy)-;1-(2-Nitrophenoxy)acetone | | CAS: | 5330-66-5 | | MF: | C9H9NO4 | | MW: | 195.17 | | EINECS: | | | Product Categories: | | | Mol File: | 5330-66-5.mol |  |
| | 1-(2-Nitrophenoxy)acetone Chemical Properties |
| Melting point | 69° | | Boiling point | 69°C | | density | 1+-.0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C9H9NO4/c1-7(11)6-14-9-5-3-2-4-8(9)10(12)13/h2-5H,6H2,1H3 | | InChIKey | PYVMIAYOZLGBQM-UHFFFAOYSA-N | | SMILES | O=C(C)COC1=CC=CC=C1[N+]([O-])=O | | EPA Substance Registry System | 2-Propanone, 1-(2-nitrophenoxy)- (5330-66-5) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 1-(2-Nitrophenoxy)acetone Usage And Synthesis |
| | 1-(2-Nitrophenoxy)acetone Preparation Products And Raw materials |
|