| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
SALOR-INT L368539-1EA manufacturers
- VUAA1
-
-
2026-08-08
- CAS:525582-84-7
- Purity:
- Supply Ability: 10g
|
| | SALOR-INT L368539-1EA Basic information |
| Product Name: | SALOR-INT L368539-1EA | | Synonyms: | N-(4-ETHYLPHENYL)-2-((4-ET-5-(3-PYRIDINYL)-4H-1,2,4-TRIAZOL-3-YL)THIO)ACETAMIDE;2-(4-ethyl-5-(3-pyridyl)(1,2,4-triazol-3-ylthio))-N-(4-ethylphenyl)acetamide;SALOR-INT L368539-1EA;N-(4-ethylphenyl)-2-((4-ethyl-5-(3-pyridinyl)-4H-1,2,4-triazol-3-yl)thio)acetamide;Acetamide, N-(4-ethylphenyl)-2-[[4-ethyl-5-(3-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-;2-{[4-Ethyl-5-(pyridin-3-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(4-ethylphenyl)acetamide;VUAA1 | | CAS: | 525582-84-7 | | MF: | C19H21N5OS | | MW: | 367.47 | | EINECS: | | | Product Categories: | | | Mol File: | 525582-84-7.mol |  |
| | SALOR-INT L368539-1EA Chemical Properties |
| density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 20mg/mL, clear | | form | powder | | pka | 12.96±0.70(Predicted) | | color | white to beige | | InChI | 1S/C19H21N5OS/c1-3-14-7-9-16(10-8-14)21-17(25)13-26-19-23-22-18(24(19)4-2)15-6-5-11-20-12-15/h5-12H,3-4,13H2,1-2H3,(H,21,25) | | InChIKey | UWCCKVJVOHTHAF-UHFFFAOYSA-N | | SMILES | CCC(C=C1)=CC=C1NC(CSC2=NN=C(C3=CN=CC=C3)N2CC)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | SALOR-INT L368539-1EA Usage And Synthesis |
| Uses | VUAA1 is an insect odorant co-receptor (Orco) agonist. VUAA1 activates both heteromeric and homomeric Orco-containing channels. VUAA1 can disrupt the destructive behaviors of nuisance insects. VUAA1 can be used for insect olfactory research[1][2]. | | Biochem/physiol Actions | VUAA1 is an agonist of the highly conserved insect odorant receptor co-receptor ion channel Orco. VUAA1 is able to activate both heteromeric and homomeric Orco-containing channels, acting as an insect repellant by over-activating an insect′s olfactory senses causing a repellent effect. | | References | [1] Corcoran JA, et al. Endogenous insensitivity to the Orco agonist VUAA1 reveals novel olfactory receptor complex properties in the specialist fly Mayetiola destructor. Sci Rep. 2018 Feb 22;8(1):3489. DOI:10.1038/s41598-018-21631-3
[2] Jones PL, et al. Functional agonism of insect odorant receptor ion channels. Proc Natl Acad Sci U S A. 2011 May 24;108(21):8821-5. DOI:10.1073/pnas.1102425108 |
| | SALOR-INT L368539-1EA Preparation Products And Raw materials |
|