| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Isopropenyl-alpha,alpha-dimethylbenzyl isocyanate manufacturers
|
| | 3-Isopropenyl-alpha,alpha-dimethylbenzyl isocyanate Basic information |
| | 3-Isopropenyl-alpha,alpha-dimethylbenzyl isocyanate Chemical Properties |
| Boiling point | 268-271 °C(lit.) | | density | 1.018 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.53(lit.) | | Fp | >230 °F | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | 1S/C13H15NO/c1-10(2)11-6-5-7-12(8-11)13(3,4)14-9-15/h5-8H,1H2,2-4H3 | | InChIKey | ZVEMLYIXBCTVOF-UHFFFAOYSA-N | | SMILES | CC(=C)c1cccc(c1)C(C)(C)N=C=O | | CAS DataBase Reference | 2094-99-7(CAS DataBase Reference) | | EPA Substance Registry System | m-Isopropenyl cumyl isocyanate (2094-99-7) |
| Hazard Codes | T+,N | | Risk Statements | 26-34-42/43-48/20-50/53 | | Safety Statements | 7-15-28-36/37/39-38-45-60-61 | | RIDADR | UN 2206 6.1/PG 3 | | WGK Germany | 2 | | RTECS | DA3685000 | | Autoignition Temperature | 838 °F | | TSCA | TSCA listed | | HS Code | 2929.10.8090 | | HazardClass | 6.1(a) | | PackingGroup | II | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 STOT RE 2 Inhalation |
| | 3-Isopropenyl-alpha,alpha-dimethylbenzyl isocyanate Usage And Synthesis |
| Uses | m-TMI can be used as a tetrafunctional isocyanate which can further be used in the development of polymer electrolyte. It can be used as a coupling agent in the preparation of jute reinforced polypropylene. | | General Description | 3-Isopropenyl-α,α-dimethylbenzyl isocyanate (m-TMI) is a telechelic derivative that shows an α-unsaturation and has an isocyanate end group. It is majorly used in polymeric synthesis. |
| | 3-Isopropenyl-alpha,alpha-dimethylbenzyl isocyanate Preparation Products And Raw materials |
|