| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
0519-85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:1,1,2-trichloroprop-1-ene CAS:21400-25-9 Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
1,1,2-TRICHLOROPROPENE manufacturers
- 1,1,2-TRICHLOROPROPENE
-
- $2.00 / 100kg
-
2025-10-13
- CAS:21400-25-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | 1,1,2-TRICHLOROPROPENE Basic information |
| Product Name: | 1,1,2-TRICHLOROPROPENE | | Synonyms: | 1,1,2-trichloro-1-propen;1,1,2-Trichloro-1-propene;1,1,2-trichloro-propen;1,1,2-trichloropropene-1;1-Propene, 1,1,2-trichloro-;Propene, 1,1,2-trichloro-;1,1,2-TRICHLOROPROPENE;1,1,2-trichloroprop-1-ene | | CAS: | 21400-25-9 | | MF: | C3H3Cl3 | | MW: | 145.41 | | EINECS: | | | Product Categories: | | | Mol File: | 21400-25-9.mol |  |
| | 1,1,2-TRICHLOROPROPENE Chemical Properties |
| Melting point | -30°C (estimate) | | Boiling point | 122.72°C (estimate) | | density | 1.3820 | | refractive index | 1.4827 | | InChI | InChI=1S/C3H3Cl3/c1-2(4)3(5)6/h1H3 | | InChIKey | LIPPKMMVZOHCIF-UHFFFAOYSA-N | | SMILES | C(/Cl)(\Cl)=C(\Cl)/C | | EPA Substance Registry System | 1-Propene, 1,1,2-trichloro- (21400-25-9) |
| | 1,1,2-TRICHLOROPROPENE Usage And Synthesis |
| | 1,1,2-TRICHLOROPROPENE Preparation Products And Raw materials |
|