1,1,2-Trichloropropene manufacturers
|
| | 1,1,2-Trichloropropene Basic information |
| Product Name: | 1,1,2-Trichloropropene | | Synonyms: | 1,1,2-trichloro-1-propen;1,1,2-Trichloro-1-propene;1,1,2-trichloro-propen;1,1,2-trichloropropene-1;1-Propene, 1,1,2-trichloro-;Propene, 1,1,2-trichloro-;1,1,2-trichloroprop-1-ene;1,1,2-Trichloropropene | | CAS: | 21400-25-9 | | MF: | C3H3Cl3 | | MW: | 145.41 | | EINECS: | | | Product Categories: | | | Mol File: | 21400-25-9.mol |  |
| | 1,1,2-Trichloropropene Chemical Properties |
| Melting point | -30°C (estimate) | | Boiling point | 122.72°C (estimate) | | density | 1.3820 | | refractive index | 1.4827 | | InChI | InChI=1S/C3H3Cl3/c1-2(4)3(5)6/h1H3 | | InChIKey | LIPPKMMVZOHCIF-UHFFFAOYSA-N | | SMILES | C(/Cl)(\Cl)=C(\Cl)/C | | EPA Substance Registry System | 1-Propene, 1,1,2-trichloro- (21400-25-9) |
| | 1,1,2-Trichloropropene Usage And Synthesis |
| | 1,1,2-Trichloropropene Preparation Products And Raw materials |
|