|
|
| | 2,3,5-Tri-O-benzyl-D-ribofuranose Basic information |
| Product Name: | 2,3,5-Tri-O-benzyl-D-ribofuranose | | Synonyms: | TRI-O-BENZYL-D-RIBOFURANOSE;2,3,5-Tri-O-benzyl-alpha-D-ribofuranose;(2S,3R,4R,5R)-3,4-Bis(benzyloxy)-5-((benzyloxy)methyl)tetrahydrofuran-2-ol;2,3,5-Tris-O-(phenylmethyl)-α-D-ribofuranose;2,3,5-Tri-O-benzyl-D-ribofuranose | | CAS: | 89615-45-2 | | MF: | C26H28O5 | | MW: | 420.5 | | EINECS: | | | Product Categories: | 13C & 2H Sugars;aldehydes;Carbohydrates & Derivatives | | Mol File: | 89615-45-2.mol |  |
| | 2,3,5-Tri-O-benzyl-D-ribofuranose Chemical Properties |
| Melting point | 54-55°C | | Boiling point | 570.547±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.21 | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Ethyl Acetate | | form | Solid | | pka | 11.954±0.70(predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1/C26H28O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25-,26+/s3 | | InChIKey | NAQUAXSCBJPECG-JBOQOWQFNA-N | | SMILES | [C@@H]1([C@H]([C@@H](O)O[C@@H]1COCC1=CC=CC=C1)OCC1=CC=CC=C1)OCC1C=CC=CC=1 |&1:0,1,2,5,r| |
| | 2,3,5-Tri-O-benzyl-D-ribofuranose Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2,3,5-Tri-O-benzyl-D-ribofuranose (cas# 89615-45-2) is a compound useful in organic synthesis. |
| | 2,3,5-Tri-O-benzyl-D-ribofuranose Preparation Products And Raw materials |
|