| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 1-Chloro-3,5-dimethyladamantane Basic information |
| | 1-Chloro-3,5-dimethyladamantane Chemical Properties |
| Boiling point | 87 °C / 4mmHg | | density | 1.02 | | refractive index | n/D1.4962 | | Fp | 93 °C | | storage temp. | 2-8°C | | solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) | | form | liquid | | color | Colourless | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C12H19Cl/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3 | | InChIKey | PXDRFQZLDWZHPX-CDECOKDKSA-N | | SMILES | C12(Cl)CC3(C)CC(CC(C)(C3)C1)C2 | | CAS DataBase Reference | 707-36-8(CAS DataBase Reference) |
| RIDADR | UN 1993 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2903890002 | | Storage Class | 13 - Non Combustible Solids |
| | 1-Chloro-3,5-dimethyladamantane Usage And Synthesis |
| Uses | 1-Chloro-3,5-dimethyladamantane is an adamantane derivative used in the preparation of organosilicon compounds with antiviral activity. Memantine impurity C. | | Uses | Building block has been shown to be used as a key intermediate in the synthesis of memantine hydrochloride, which was reported to be a FDA approved drug for Alzheimer′s treatment. |
| | 1-Chloro-3,5-dimethyladamantane Preparation Products And Raw materials |
|