1-METHYL 2-NITROTEREPHTHALATE manufacturers
- 1-Methyl-2-nitroterephthalate
-
- $42.29 / 25Kg/Drum
-
2026-03-18
- CAS:35092-89-8
- Min. Order: 25Kg/Drum
- Purity: ≥ 97.0% (HPLC-a/a), min
- Supply Ability: 3tons
|
| | 1-METHYL 2-NITROTEREPHTHALATE Basic information |
| | 1-METHYL 2-NITROTEREPHTHALATE Chemical Properties |
| Melting point | 176-178 °C (lit.) | | Boiling point | 393.4±32.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | vapor pressure | 0.001Pa at 20℃ | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | 3.09±0.10(Predicted) | | InChI | 1S/C9H7NO6/c1-16-9(13)6-3-2-5(8(11)12)4-7(6)10(14)15/h2-4H,1H3,(H,11,12) | | InChIKey | MIIADZYPHVTLPR-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1[N+]([O-])=O)C(O)=O | | LogP | 1.26 at 23℃ and pH6 | | CAS DataBase Reference | 35092-89-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 1 | | Hazard Note | Irritant | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-METHYL 2-NITROTEREPHTHALATE Usage And Synthesis |
| | 1-METHYL 2-NITROTEREPHTHALATE Preparation Products And Raw materials |
|