| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:BISINDOLYLMALEIMIDE II Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
EMMX Biotechnology LLC
|
| Tel: |
888-539-0666 |
| Email: |
info@emmx.com |
| Products Intro: |
Product Name:Bisindolylmaleimide II CAS:137592-45-1 Purity:98% HPLC Package:5mg;10mg;25mg;50mg;100mg;250mg;500mg;1g
|
|
| | BISINDOLYLMALEIMIDE II Basic information |
| | BISINDOLYLMALEIMIDE II Chemical Properties |
| Boiling point | 709.9±60.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO: soluble | | form | solid | | pka | 8.17±0.60(Predicted) | | color | Yellow to orange | | biological source | synthetic (organic) | | InChIKey | LBFDERUQORUFIN-UHFFFAOYSA-N | | SMILES | CN1CCCC1CCn2cc(C3=C(C(=O)NC3=O)c4c[nH]c5ccccc45)c6ccccc26 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | BISINDOLYLMALEIMIDE II Usage And Synthesis |
| Uses | Bisindolylmaleimide II, is a potent ATP-competitive protein kinase C (PKC) inhibitor. In addition it inhibits PDK1 (IC50 = 14 μM), an important kinase in the insulin signaling pathway, and PKA (IC50 = 2.94 μM). | | Biological Activity | Bisindolylmaleimide II (BIS II) acts as a dual protein kinase A/C (PKA/C) inhibitor. | | storage | -20°C |
| | BISINDOLYLMALEIMIDE II Preparation Products And Raw materials |
|