| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
4-Methylpentanoic-d11 acid manufacturers
|
| | 4-Methylpentanoic-d11 acid Basic information |
| Product Name: | 4-Methylpentanoic-d11 acid | | Synonyms: | (iso-Caproic Acid)(4-Methylvaleric Acid);4-Methylpentanoic acid-d11;4-Methylvaleric-d11 acid;4-Methylpentanoic-d11 Acid (Standard);4-Methylvaleric acid-[d11];4-Methylpentanoic-d11 acid | | CAS: | 344298-98-2 | | MF: | C6H12O2 | | MW: | 116.16 | | EINECS: | | | Product Categories: | | | Mol File: | 344298-98-2.mol |  |
| | 4-Methylpentanoic-d11 acid Chemical Properties |
| form | liquid | | InChI | 1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/i1D3,2D3,3D2,4D2,5D | | InChIKey | FGKJLKRYENPLQH-KUXNVAAFSA-N | | SMILES | OC(C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])=O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Skin Irrit. 2 |
| | 4-Methylpentanoic-d11 acid Usage And Synthesis |
| Uses | 4-Methylpentanoic-d11 Acid can be used as as GABA-A receptor modulators. |
| | 4-Methylpentanoic-d11 acid Preparation Products And Raw materials |
|