|
|
| | 1,10-Phenanthroline, 2-(4-bromo-1-
naphthalenyl)-9-phenyl- Basic information |
| | 1,10-Phenanthroline, 2-(4-bromo-1-
naphthalenyl)-9-phenyl- Chemical Properties |
| Boiling point | 510.6±45.0 °C(Predicted) | | density | 1.485±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.13±0.30(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C18H11BrN2/c19-16-11-9-14-7-6-13-8-10-15(12-4-2-1-3-5-12)20-17(13)18(14)21-16/h1-11H | | InChIKey | RONHNDLXJVQZOE-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=C(C2=CC=CC=C2)C=C3)C=CC=1Br |
| | 1,10-Phenanthroline, 2-(4-bromo-1-
naphthalenyl)-9-phenyl- Usage And Synthesis |
| Uses | 1,10-Phenanthroline, 2-(4-bromo-1- naphthalenyl)-9-phenyl- is an organic heterocyclic compound that can be used as a luminescent material. |
| | 1,10-Phenanthroline, 2-(4-bromo-1-
naphthalenyl)-9-phenyl- Preparation Products And Raw materials |
|