|
|
| | Brusatol Basic information |
| Product Name: | Brusatol | | Synonyms: | β-D-Glucopyranoside, (1S)-2-hydroxy-1-[[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]methyl]ethyl;RegalosideD/RegalosideE;Regaloside;Regaloside E;regaloside D | | CAS: | 120601-66-3 | | MF: | C18H24O10 | | MW: | 400.38 | | EINECS: | | | Product Categories: | | | Mol File: | 120601-66-3.mol |  |
| | Brusatol Chemical Properties |
| Boiling point | 724.9±60.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | pka | 9.67±0.26(Predicted) | | InChIKey | HHNPREGNVCFCOP-UKECALQGNA-N | | SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)[C@@H](CO)COC(=O)/C=C/C1C=CC(O)=CC=1 |&1:1,2,3,5,7,12,r| |
| | Brusatol Usage And Synthesis |
| Uses | Regaloside D is a phenylpropanoid isolated from Lilium Longiflorum[1]. | | References | [1] Kim BR, et al. Purification of Phenylpropanoids from the Scaly Bulbs of Lilium Longiflorum by CPC and Determination of Their DPP-IV Inhibitory Potentials. ACS Omega. 2020;5(8):4050-4057. Published 2020 Feb 20. DOI:10.1021/acsomega.9b03649 |
| | Brusatol Preparation Products And Raw materials |
|