[1,2-Bis(diphenyphosphino)ethane]dichlorocobalt(II) manufacturers
|
| | [1,2-Bis(diphenyphosphino)ethane]dichlorocobalt(II) Basic information | | Reactions |
| | [1,2-Bis(diphenyphosphino)ethane]dichlorocobalt(II) Chemical Properties |
| Melting point | 260 °C (dec.)(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | green | | Water Solubility | Insoluble in water. | | Sensitive | Hygroscopic | | InChI | 1S/C26H24P2.2ClH.Co/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;;/h1-20H,21-22H2;2*1H;/q;;;+2/p-2 | | InChIKey | SYTWXWRJCLAZFP-UHFFFAOYSA-L | | SMILES | Cl[Co]Cl.C(CP(c1ccccc1)c2ccccc2)P(c3ccccc3)c4ccccc4 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | [1,2-Bis(diphenyphosphino)ethane]dichlorocobalt(II) Usage And Synthesis |
| Reactions |
- Catalyst used for the hydrovinylation of styrene.
- Cobalt-catalyzed hydroalkylation of [60] fullerene with active alkyl bromides.
- Cobalt-catalyzed 1,4-addition of organoboronic acids to activated alkenes.
| | Uses | Dichloro[bis(1,2-diphenylphosphino)ethane]cobalt(II) is used as a catalyst for regio- and stereoselective intermolecular enzyme coupling, cross-coupling reactions of alkyl halides with aryl Grignard reagents, hydrovinylation of styrene, tandem radical cyclization and cross-coupling, dimethylation, hydrodechlorination and addition reactions. | | reaction suitability | core: cobalt reagent type: catalyst |
| | [1,2-Bis(diphenyphosphino)ethane]dichlorocobalt(II) Preparation Products And Raw materials |
|