| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(tert-Butylcarbonylamino)phenylboronic acid Basic information |
| Product Name: | 2-(tert-Butylcarbonylamino)phenylboronic acid | | Synonyms: | 2-(PIVALOYLAMINO)PHENYLBORONIC ACID;2-[(2,2-DIMETHYLPROPANOYL)AMINO]PHENYLBORONIC ACID;2-(2,2-DIMETHYL-PROPIONYLAMINO)PHENYLBORONIC ACID;2-(Pivaloylamino)benzeneboronic acid;2-(2,2,2-Trimethylacetamido)benzeneboronic acid, 95%;2-(TERT-BUTYLCARBONYLAMINO)PHENYLBORONIC ACID;2-(PIVALOYLAMINO)PHENYLBORONIC ACID;2-(TERT-BUTYLCARBONYLAMINO)PHENYLBORONIC ACID;2-[(2,2-DIMETHYLPROPANOYL)AMINO]PHENYLBORONIC ACID;AKOS BRN-0489;2-(PIVALOYLAMINO)BENZENEBORONIC ACID;2-(2,2,2-TRIMETHYLACETAMIDO)BENZENEBORONIC ACID;AKOS BRN-0489;2-(2,2-DIMETHYL-1-OXOPROPYL)AMINO PHENYL BORONIC ACID | | CAS: | 146140-95-6 | | MF: | C11H16BNO3 | | MW: | 221.06 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Aromatics;Boron Derivatives;Intermediates | | Mol File: | 146140-95-6.mol |  |
| | 2-(tert-Butylcarbonylamino)phenylboronic acid Chemical Properties |
| Melting point | 268-271℃ | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol | | form | Solid | | pka | 8.52±0.53(Predicted) | | color | White | | InChI | 1S/C11H16BNO3/c1-11(2,3)10(14)13-9-7-5-4-6-8(9)12(15)16/h4-7,15-16H,1-3H3,(H,13,14) | | InChIKey | MXRAJVMTCAUABO-UHFFFAOYSA-N | | SMILES | B(O)(O)c1c(cccc1)NC(=O)C(C)(C)C | | CAS DataBase Reference | 146140-95-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 2-(tert-Butylcarbonylamino)phenylboronic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | An intermediate for the synthesis of Norharmane as well as DNA intercalating agents. |
| | 2-(tert-Butylcarbonylamino)phenylboronic acid Preparation Products And Raw materials |
|