|
|
| | 2-BIPHENYLMAGNESIUM BROMIDE Basic information | | Application |
| | 2-BIPHENYLMAGNESIUM BROMIDE Chemical Properties |
| Boiling point | 65 °C | | density | 0.800 g/mL at 25 °C(lit.) | | Fp | -40 °F | | storage temp. | 2-8°C | | InChI | 1S/C12H9.BrH.Mg/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h1,3-10H;1H;/q;;+1/p-1 | | InChIKey | NACCJOIEZISYCU-UHFFFAOYSA-M | | SMILES | Br[Mg]c1ccc(cc1)-c2ccccc2 |
| | 2-BIPHENYLMAGNESIUM BROMIDE Usage And Synthesis |
| Application | 4-Diphenylmagnesium bromide can be used as a pharmaceutical synthesis intermediate. | | Chemical Properties | Light brown liquid | | reaction suitability | reaction type: Grignard Reaction | | Synthesis | Add 12.5g of 4-bromobiphenyl, 27.38g of magnesium, 50g of tetrahydrofuran into the reactor, add 0.125g of single iodine particles to initiate, make up 200g of tetrahydrofuran, controlled temperature 40 , dropwise addition of 237.5g of 4-bromobiphenyl and 350g of tetrahydrofuran mixed solution, the reaction of 2h and then reduce the temperature to 4 , to produce 4-diphenylmagnesium bromide. |
| | 2-BIPHENYLMAGNESIUM BROMIDE Preparation Products And Raw materials |
|