|
|
| | Hydrocortisone hemisuccinate hydrate Basic information |
| Product Name: | Hydrocortisone hemisuccinate hydrate | | Synonyms: | Hydrocortisone 21-hemisuccinat;HYDROCORTISONEHEMISUCCINATE,MONOHYDRATE,USP;Hydrocortisone hemisuccinate hydrate;(11b-)-21-(3-Carboxy-1-oxopropoxy)-11,17-dihydroxypregn-4-ene-3,20-dione monohydrate;CORTISOL HEMISUCCINATE MONOHYDRATE;HYDROCORTISONE HEMISUCCINATE, MONOHYDRATE;4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxo-ethoxy]-4-oxo-butanoic acid hydrate;4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid hydrate | | CAS: | 83784-20-7 | | MF: | C25H36O9 | | MW: | 480.55 | | EINECS: | | | Product Categories: | Steroids | | Mol File: | 83784-20-7.mol |  |
| | Hydrocortisone hemisuccinate hydrate Chemical Properties |
| Melting point | >195oC (dec.) | | storage temp. | -20°C Freezer | | solubility | Acetone (Slightly), DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | powder | | color | White to Off-White | | Major Application | pharmaceutical | | InChIKey | AFLWPAGYTPJSEY-OABDJCHQNA-N | | SMILES | C[C@]12C[C@H](O)[C@]3([H])[C@]4(CCC(=O)C=C4CC[C@@]3([H])[C@]1([H])CC[C@]2(O)C(=O)COC(=O)CCC(=O)O)C.O |&1:1,3,5,7,16,18,22,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2937290000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | Hydrocortisone hemisuccinate hydrate Usage And Synthesis |
| Uses | Adrenocortical steroid. | | Uses | Hydrocortisone Hemisuccinate Hydrate is a metabolite of Hydrocortisone (H714615), a steroid hormone, specifically a glucocorticoid, produced by the zona fasciculata of the adrenal gland. Cortisol is released in response to stress and a low level of blood glucocorticoids. |
| | Hydrocortisone hemisuccinate hydrate Preparation Products And Raw materials |
|