| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Bromo-4-(heptadecafluorooctyl)benzene Basic information |
| Product Name: | 1-Bromo-4-(heptadecafluorooctyl)benzene | | Synonyms: | 1-Bromo-4-(heptadecafluorooctyl)benzene >=95.0%;Benzene, 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)- | | CAS: | 206560-77-2 | | MF: | C14H4BrF17 | | MW: | 575.06 | | EINECS: | | | Product Categories: | | | Mol File: | 206560-77-2.mol |  |
| | 1-Bromo-4-(heptadecafluorooctyl)benzene Chemical Properties |
| Melting point | 35-40 °C | | Boiling point | 271.3±40.0 °C(Predicted) | | density | 1.735±0.06 g/cm3(Predicted) | | BRN | 7895098 | | InChI | 1S/C14H4BrF17/c15-6-3-1-5(2-4-6)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)32/h1-4H | | InChIKey | XDEOJAJPLXXYKA-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(Br)cc1 | | EPA Substance Registry System | 1-Bromo-4-(heptadecafluorooctyl)benzene (206560-77-2) |
| WGK Germany | 3 | | F | 10 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 1-Bromo-4-(heptadecafluorooctyl)benzene Usage And Synthesis |
| | 1-Bromo-4-(heptadecafluorooctyl)benzene Preparation Products And Raw materials |
|