| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(Fmoc-amino)ethyl bromide Basic information |
| | 2-(Fmoc-amino)ethyl bromide Chemical Properties |
| Melting point | 122-124 °C | | Boiling point | 491.9±28.0 °C(Predicted) | | density | 1.416±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.13±0.46(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C17H16BrNO2/c18-9-10-19-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,19,20) | | InChIKey | GDIPNIOJNLDDRP-UHFFFAOYSA-N | | SMILES | BrCCNC(OCC1C(C=CC=C2)=C2C3=C1C=CC=C3)=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2-(Fmoc-amino)ethyl bromide Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-(Fmoc-amino)ethyl Bromide is a starting material used to prepare tetrahydroisoquinoline compounds as GPR119 modulators useful in treatment and prevention of GPR119-assocd. disorders. | | reaction suitability | reagent type: cross-linking reagent |
| | 2-(Fmoc-amino)ethyl bromide Preparation Products And Raw materials |
|