|
|
| | O-Desmethylnaproxen Basic information |
| | O-Desmethylnaproxen Chemical Properties |
| Melting point | 182-183 °C | | Boiling point | 432.1±20.0 °C(Predicted) | | density | 1.297±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: soluble | | form | solid | | pka | 4.87±0.30(Predicted) | | color | white | | BRN | 8838512 | | Major Application | forensics and toxicology
pharmaceutical (small molecule) | | InChI | 1S/C13H12O3/c1-8(13(15)16)9-2-3-11-7-12(14)5-4-10(11)6-9/h2-8,14H,1H3,(H,15,16)/t8-/m0/s1 | | InChIKey | XWJUDDGELKXYNO-QMMMGPOBSA-N | | SMILES | C[C@H](C(O)=O)c1ccc2cc(O)ccc2c1 | | CAS DataBase Reference | 52079-10-4 |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Skin Sens. 1 |
| | O-Desmethylnaproxen Usage And Synthesis |
| Chemical Properties | Off-Whie to Pale Pink Solid | | Uses | A metabolite of Naproxen | | Uses | O-Desmethylnaproxen can be used for assaying naproxen metabolites. | | Definition | ChEBI: A member of the class of naphthols that is naproxen in which the 6-methoxy group has been demethylated. | | Biochem/physiol Actions | CYP2C9 metabolite of naproxen |
| | O-Desmethylnaproxen Preparation Products And Raw materials |
|