| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
Netropsin dihydrochloride hydrate manufacturers
|
| | Netropsin dihydrochloride hydrate Basic information |
| Product Name: | Netropsin dihydrochloride hydrate | | Synonyms: | 1H-Pyrrole-2-carboxamide, 4-(aminoiminomethyl)aminoacetylamino-N-5-(3-amino-3-iminopropyl)aminocarbonyl-1-methyl-1H-pyrrol-3-yl-1-methyl-, dihydrochloride;Netropsin hydrate dihydrochloride;Nsc275885;Netropsin, 2 HCl, Streptomycesnetropsis (1.24791);NETROPSIN DIHYDROCHLORIDE HYDRATE 96%;netropsin2HClhydrate | | CAS: | 18133-22-7 | | MF: | C18H27ClN10O3 | | MW: | 466.93 | | EINECS: | | | Product Categories: | | | Mol File: | 18133-22-7.mol |  |
| | Netropsin dihydrochloride hydrate Chemical Properties |
| storage temp. | 2-8°C | | solubility | H2O: soluble1mg/mL | | form | powder | | color | faint yellow | | biological source | Streptomyces netropsis | | Water Solubility | H2O: 1mg/mL | | InChIKey | SDRHUASONSRLFR-UHFFFAOYSA-N | | SMILES | [H]Cl.[H]Cl.NC(CCNC(C1=CC(NC(C2=CC(NC(CNC(N)=N)=O)=CN2C)=O)=CN1C)=O)=N |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36/37 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | RTECS | DW2973000 | | HS Code | 2941900000 | | Storage Class | 11 - Combustible Solids |
| | Netropsin dihydrochloride hydrate Usage And Synthesis |
| Uses | Netropsin Dihydrochloride is DNA minor groove binding ligand. | | Biochem/physiol Actions | Netropsin is an unusual n-methylpyrrole-containing oligopeptide that binds to AT-rich sequences of dsDNA, especially in the minor groove. Thus, it protects such regions from DNase I and other endonucleases, and also inhibits topoisomerases. Netropsin disrupts the cell cycle, prolonging G and arresting in G. |
| | Netropsin dihydrochloride hydrate Preparation Products And Raw materials |
|