| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
CIBACRON BLUE 3G-A manufacturers
|
| | CIBACRON BLUE 3G-A Basic information |
| Product Name: | CIBACRON BLUE 3G-A | | Synonyms: | 1-amino-4-[4-[[4-chloro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-3-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid;1-Amino-4-{[4-({4-chloro-6-[(2-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-3-sulfophenyl]amino}-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid;Clbacron Blue F3G-A;2-Anthracenesulfonic acid, 1-amino-4-4-4-chloro-6-(2-sulfophenyl)amino-1,3,5-triazin-2-ylamino-3-sulfophenylamino-9,10-dihydro-9,10-dioxo-;CIBACRON BLUE 3G;1-Amino-4-[[4-[[4-chloro-6-[[3-sulfophenyl]amino]-1,3,5-triazin-2-yl]amino]-3-sulfophenyl]amino]-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid;1-Amino-4-[4-[4-(3-sulfoanilino)-6-chloro-1,3,5-triazine-2-ylamino]-3-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid;2-Chloro-4-(3-sulfoanilino)-6-[2-sulfo-4-(1-amino-2-sulfo-9,10-dioxoanthracene-4-ylamino)anilino]-1,3,5-triazine | | CAS: | 84166-13-2 | | MF: | C29H20ClN7O11S3 | | MW: | 774.16 | | EINECS: | | | Product Categories: | C;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 84166-13-2.mol |  |
| | CIBACRON BLUE 3G-A Chemical Properties |
| density | 1.845±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | H2O: 10 mg/mL, blue | | form | Solid | | pka | -1.22±0.20(Predicted) | | color | Brown to black | | Water Solubility | H2O: 10mg/mL, blue | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | YKCWQPZFAFZLBI-UHFFFAOYSA-N | | SMILES | Nc1c(cc(Nc2ccc(Nc3nc(Cl)nc(Nc4ccccc4S(O)(=O)=O)n3)c(c2)S(O)(=O)=O)c5C(=O)c6ccccc6C(=O)c15)S(O)(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CIBACRON BLUE 3G-A Usage And Synthesis |
| Uses | When immobilized using an insoluble porous support matrix such as agarose, Cibacron Blue 3GA is used for affinity chromatography purification of enzymes. This affinity has been attributed to a structural similarity between the dye and the natural ligands for proteins with cofactor binding domains. | | Biochem/physiol Actions | Cibacron Blue 3GA is an anionic anthraquinone dye. It acts as a P2-purinoceptor antagonist and inhibits stimulus-evoked glutamate release by rat brain cortical tissue. Cibacron Blue 3GA inhibits OXA-1 and OXA-2 β-lactamases and was used to observe the binding of ligands to OXA-1 β-lactamase by monitoring tryptophan fluorescence. |
| | CIBACRON BLUE 3G-A Preparation Products And Raw materials |
|