| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:Bis(pentafluorophenyl)zinc CAS:1799-90-2 Remarks:RA10760015
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Bis(pentafluorophenyl)zinc CAS:1799-90-2 Purity:97% Package:1G Remarks:566748-1G
|
BIS(PENTAFLUOROPHENYL)ZINC 97 manufacturers
|
| | BIS(PENTAFLUOROPHENYL)ZINC 97 Basic information |
| | BIS(PENTAFLUOROPHENYL)ZINC 97 Chemical Properties |
| Melting point | 100-105 °C (lit.) | | form | powder | | InChI | 1S/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9; | | InChIKey | RKAUXNIMJYZJDE-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c([Zn]c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| WGK Germany | 3 | | HS Code | 29319000 | | Storage Class | 11 - Combustible Solids |
| | BIS(PENTAFLUOROPHENYL)ZINC 97 Usage And Synthesis |
| reaction suitability | reagent type: catalyst core: zinc |
| | BIS(PENTAFLUOROPHENYL)ZINC 97 Preparation Products And Raw materials |
|