| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5-
CAS:30354-91-7
Purity:95+% Remarks:D61040
|
| Company Name: |
Shanghai T&W Pharmaceutical Co., Ltd.
|
| Tel: |
+86 21 61551611 |
| Email: |
|
| Products Intro: |
Product Name:2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5-
CAS:30354-91-7
Purity:98% Package:50kg;25kg;10kg;5kg;500g;500mg;
|
2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5- manufacturers
|
| | 2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5- Basic information |
| Product Name: | 2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5- | | Synonyms: | JR-6728, 6-(4-Methoxyphenyl)-1,3,5-triazine-2,4-diamine, 97%;2,4-diamino-6-(4-methoxyphenyl)-s-triazine;5-triazine-2,4-diamine,6-(4-methoxyphenyl)-3;2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5-;1,3,5-Triazine-2,4-diaMine, 6-(4-Methoxyphenyl)-;2,4-Diamino-6-(4-methoxyphenyl)-1,3,5-triazine 97% | | CAS: | 30354-91-7 | | MF: | C10H11N5O | | MW: | 217.23 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Building Blocks;Heterocyclic Building Blocks;Triazines | | Mol File: | 30354-91-7.mol |  |
| | 2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5- Chemical Properties |
| Melting point | 231-235 °C (lit.) | | Boiling point | 518.0±52.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | pka | 4.36±0.10(Predicted) | | form | solid | | InChI | 1S/C10H11N5O/c1-16-7-4-2-6(3-5-7)8-13-9(11)15-10(12)14-8/h2-5H,1H3,(H4,11,12,13,14,15) | | InChIKey | WBDWTNWLWBQFJU-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-c2nc(N)nc(N)n2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | RTECS | WY0775054 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5- Usage And Synthesis |
| | 2 4-DIAMINO-6-(4-METHOXYPHENYL)-1 3 5- Preparation Products And Raw materials |
|