| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(4-Bromophenyl)thiophene-2-carboxylic hydrazide Basic information |
| | 5-(4-Bromophenyl)thiophene-2-carboxylic hydrazide Chemical Properties |
| Melting point | 189-193 °C(lit.) | | density | 1.581±0.06 g/cm3(Predicted) | | pka | 12.20±0.10(Predicted) | | form | solid | | InChI | 1S/C11H9BrN2OS/c12-8-3-1-7(2-4-8)9-5-6-10(16-9)11(15)14-13/h1-6H,13H2,(H,14,15) | | InChIKey | HFKIMTDDJJSIEY-UHFFFAOYSA-N | | SMILES | NNC(=O)c1ccc(s1)-c2ccc(Br)cc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-(4-Bromophenyl)thiophene-2-carboxylic hydrazide Usage And Synthesis |
| | 5-(4-Bromophenyl)thiophene-2-carboxylic hydrazide Preparation Products And Raw materials |
|