- (R)-Methyglycidate
-
-
2026-07-13
- CAS:111058-32-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
|
| | (R)-Methyglycidate Basic information |
| Product Name: | (R)-Methyglycidate | | Synonyms: | methyl (r)-oxiranecarboxylate;R-METHYL OXIRANECARBOXYLATE;(r)-methyglycidate;METHYL (2R)-GLYCIDATE 97% (94% EE/GLC);(R)-Methyl oxirane-2-carboxylate;(R)-Methyclycidate;(R)-Glycidic Acid Methyl Ester;Methyl (2R)-glycidate optical purity ee: 94% (GLC), 97% | | CAS: | 111058-32-3 | | MF: | C4H6O3 | | MW: | 102.09 | | EINECS: | 601-036-5 | | Product Categories: | | | Mol File: | 111058-32-3.mol |  |
| | (R)-Methyglycidate Chemical Properties |
| alpha | 32 º (c=1, chloroform) | | Boiling point | 97.4±15.0 °C(Predicted) | | density | 1.166 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.42(lit.) | | Fp | 162 °F | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Soluble), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless | | Optical Rotation | [α]20/D +32°, c = 1 in chloroform | | Stability: | Volatile | | InChI | InChI=1S/C4H6O3/c1-6-4(5)3-2-7-3/h3H,2H2,1H3/t3-/m1/s1 | | InChIKey | YKNYRRVISWJDSR-GSVOUGTGSA-N | | SMILES | O1C[C@@H]1C(OC)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2910900090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-Methyglycidate Usage And Synthesis |
| Chemical Properties | (R)-Methyglycidate is White Solid | | Uses | (R)-Methyglycidate is used in the preparation of antibacterial oxazolidinones. |
| | (R)-Methyglycidate Preparation Products And Raw materials |
|