| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2-(4-Bromophenyl)-6-(4-chlorophenyl) Basic information |
| | 2-(4-Bromophenyl)-6-(4-chlorophenyl) Chemical Properties |
| Melting point | 291-294 °C (lit.) | | InChI | 1S/C18H11BrClNO2/c19-14-5-1-11(2-6-14)16-9-13(18(22)23)10-17(21-16)12-3-7-15(20)8-4-12/h1-10H,(H,22,23) | | InChIKey | APLDOGUHCNVFLZ-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(nc(c1)-c2ccc(Br)cc2)-c3ccc(Cl)cc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(4-Bromophenyl)-6-(4-chlorophenyl) Usage And Synthesis |
| Uses | 2-(4-Bromophenyl)-6-(4-chlorophenyl)pyridine-4-carboxylic acid [BPCPPCA] bears three functional groups: bromophenyl, chlorophenyl and carboxylic acid group. These groups facilitate the deposition of BPCPPCA molecules on the surface of a bulk insulator (calcite) at room temperature leading to hierarchical polymerization. | | General Description | 2-(4-Bromophenyl)-6-(4-chlorophenyl)pyridine-4-carboxylic acid [BPCPPCA] bears three functional groups: bromophenyl, chlorophenyl and carboxylic acid group. These groups facilitate the deposition of BPCPPCA molecules on the surface of a bulk insulator (calcite) at room temperature leading to hierarchical polymerization. |
| | 2-(4-Bromophenyl)-6-(4-chlorophenyl) Preparation Products And Raw materials |
|