| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(4-Bromophenyl)-2-thiazoleacetonitrile Basic information |
| | 4-(4-Bromophenyl)-2-thiazoleacetonitrile Chemical Properties |
| Melting point | 125-129 °C (lit.) | | storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | Light yellow to brown Solid | | InChI | 1S/C11H7BrN2S/c12-9-3-1-8(2-4-9)10-7-15-11(14-10)5-6-13/h1-4,7H,5H2 | | InChIKey | VBHJUUAUIGGAPS-UHFFFAOYSA-N | | SMILES | Brc1ccc(cc1)-c2csc(CC#N)n2 |
| Hazard Codes | T | | Risk Statements | 25-37/38-41 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4-(4-Bromophenyl)-2-thiazoleacetonitrile Usage And Synthesis |
| | 4-(4-Bromophenyl)-2-thiazoleacetonitrile Preparation Products And Raw materials |
|