|
|
| | (S)-Boc-3-methoxy-beta-Phe-OH Basic information |
| Product Name: | (S)-Boc-3-methoxy-beta-Phe-OH | | Synonyms: | (3S)-3-{[(tert-butoxy)carbonyl]amino}-3-(3-methoxyphenyl)propanoic acid;Boc-3-Methoxy-L-b-phenylalanine;(s)-boc-3-methoxy-β-phe-oh;Boc-b-Phe(3-OMe)-OH;(S)-3-(Boc-amino)-3-(3-methoxyphenyl)propionic acid, Boc-3-methoxy-D-β-phenylalanine;(3S)-3-(3-Methoxyphenyl)-3-[(2-Methylpropan-2-yl)oxycarbonylaMino]propanoic acid;(S)-3-((tert-Butoxycarbonyl)amino)-3-(3-methoxyphenyl)propanoic acid;(Tert-Butoxy)Carbonyl (S)-3-Amino-3-(3-methoxy-phenyl)propionic acid | | CAS: | 499995-77-6 | | MF: | C15H21NO5 | | MW: | 295.33 | | EINECS: | | | Product Categories: | | | Mol File: | 499995-77-6.mol |  |
| | (S)-Boc-3-methoxy-beta-Phe-OH Chemical Properties |
| Boiling point | 458.5±45.0 °C(Predicted) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.33±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO5/c1-15(2,3)21-14(19)16-12(9-13(17)18)10-6-5-7-11(8-10)20-4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/t12-/m0/s1 | | InChIKey | DNXONWHJJNOKEU-LBPRGKRZSA-N | | SMILES | COc1cccc(c1)[C@H](CC(O)=O)NC(=O)OC(C)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (S)-Boc-3-methoxy-beta-Phe-OH Usage And Synthesis |
| | (S)-Boc-3-methoxy-beta-Phe-OH Preparation Products And Raw materials |
|