| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid Basic information |
| | Boc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid Chemical Properties |
| Boiling point | 453.9±40.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.27±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(8-12(17)18)9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 | | InChIKey | ZPXVKCUGZBGIBW-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)c1ccc(Cl)cc1 | | CAS DataBase Reference | 479064-90-9(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-(S)-3-Amino-3-(4-chlorophenyl)propionic acid Preparation Products And Raw materials |
|