| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 3-Quinuclidinyl xanthene-9-carboxylate H Basic information |
| | 3-Quinuclidinyl xanthene-9-carboxylate H Chemical Properties |
| Melting point | 195-198 °C | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/2C21H21NO3.C2H2O4/c2*23-21(25-19-13-22-11-9-14(19)10-12-22)20-15-5-1-3-7-17(15)24-18-8-4-2-6-16(18)20;3-1(4)2(5)6/h2*1-8,14,19-20H,9-13H2;(H,3,4)(H,5,6) | | InChIKey | KBKSAAZOXNEJTC-UHFFFAOYSA-N | | SMILES | OC(=O)C(O)=O.O=C(OC1CN2CC[C@@H]1CC2)C3c4ccccc4Oc5ccccc35.O=C(OC6CN7CC[C@@H]6CC7)C8c9ccccc9Oc%10ccccc8%10 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Quinuclidinyl xanthene-9-carboxylate H Usage And Synthesis |
| | 3-Quinuclidinyl xanthene-9-carboxylate H Preparation Products And Raw materials |
|