| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:1-Octylguanidine heMisulfate CAS:21409-35-8 Purity:97% Package:5G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1-Octylguanidine hemisulfate CAS:21409-35-8 Purity:97% Package:5G Remarks:382213-5G
|
| Company Name: |
Shanghai Rechem science Co., Ltd.
|
| Tel: |
021-31433387 15618786686 |
| Email: |
sales@rechemscience.com |
| Products Intro: |
CAS:21409-35-8 Purity:95% Package:1g;5g;10g
|
|
| | 1-OCTYLGUANIDINE HEMISULFATE 97 Basic information |
| | 1-OCTYLGUANIDINE HEMISULFATE 97 Chemical Properties |
| InChI | 1S/2C9H21N3.H2O4S/c2*1-2-3-4-5-6-7-8-12-9(10)11;1-5(2,3)4/h2*2-8H2,1H3,(H4,10,11,12);(H2,1,2,3,4) | | InChIKey | DTTVLDRWEFQROK-UHFFFAOYSA-N | | SMILES | OS(O)(=O)=O.CCCCCCCCNC(N)=N.CCCCCCCCNC(N)=N |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | MF5500000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-OCTYLGUANIDINE HEMISULFATE 97 Usage And Synthesis |
| Uses | 1-Octylguanidine hemisulfate is a guanidine derivative. Octyl guanidine sulfate is prepared from S-methylisothiourea sulfate and octylamine. | | General Description | 1-Octylguanidine hemisulfate is a guanidine derivative. Octyl guanidine sulfate is prepared from S-methylisothiourea sulfate and octylamine. |
| | 1-OCTYLGUANIDINE HEMISULFATE 97 Preparation Products And Raw materials |
|