| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | SB 204070 Basic information |
| Product Name: | SB 204070 | | Synonyms: | SB 204070;(1-butyl-4-piperidinyl)methyl-8-amino-7-chloro-1,4-benzodioxane-5-carboxylate hydrochloride;(1-Butyl-4-piperidinyl)methyl-8-amino-7-chloro-1,4-benzodioxane-5-carboxylate;1,4-Benzodioxin-5-carboxylic acid, 8-amino-7-chloro-2,3-dihydro-, (1-butyl-4-piperidinyl)methyl ester;SB-204070 hydrochloride solid, >=97% (HPLC);(1-Butylpiperidin-4-yl)methyl 8-amino-7-chloro-2,3-dihydrobenzo[b][1,4]dioxine-5-carboxylate;SB 204070 HCl | | CAS: | 148702-58-3 | | MF: | C19H27ClN2O4 | | MW: | 382.88 | | EINECS: | | | Product Categories: | | | Mol File: | 148702-58-3.mol |  |
| | SB 204070 Chemical Properties |
| Melting point | 243-245 °C(lit.) | | solubility | H2O: 20 mg/mL with heating | | form | solid | | Water Solubility | H2O: 20mg/mL (with heating) | | InChI | 1S/C19H27ClN2O4.ClH/c1-2-3-6-22-7-4-13(5-8-22)12-26-19(23)14-11-15(20)16(21)18-17(14)24-9-10-25-18;/h11,13H,2-10,12,21H2,1H3;1H | | InChIKey | YEQGKAOSYSXEPU-UHFFFAOYSA-N | | SMILES | Cl[H].CCCCN1CCC(CC1)COC(=O)c2cc(Cl)c(N)c3OCCOc23 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | SB 204070 Usage And Synthesis |
| Uses | SB 204070 is a selective 5-HT4 antagonist. | | Biological Activity | SB-204070 is a highly potent and specific antagonist of 4-HT4 receptor. It inhibits cholinergic and noncholinergic transmission and blocks the contractions of proximal colon in guinea pigs and relaxation of human colon circular smooth muscle.', 'Selective 5-HT4 serotonin receptor antagonist. |
| | SB 204070 Preparation Products And Raw materials |
|