| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene manufacturers
|
| | 2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene Basic information |
| Product Name: | 2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene | | Synonyms: | 1,4-Bis(chloromethyl)-2-(2-ethylhexyloxy)-5-methoxybenzene;2,5-BIS(CHLOROMETHYL)-1-METHOXY-4-(2-ETH;2 5-BIS(CHLOROMETHYL)-1-METHOXY-4-(2-;2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene;2,5-Bis(chloromethyl)-4-(2-ethylhexyloxy)anisole, 98%;2,5-Bis(chloromethyl;2,5-Bis(chloroMethyl )-1-methoxy-4-(2-Ethyl hexyloxy)benzene,98%;Benzene, 1,4-bis(chloromethyl)-2-[(2-ethylhexyl)oxy]-5-methoxy- | | CAS: | 146370-52-7 | | MF: | C17H26Cl2O2 | | MW: | 333.29 | | EINECS: | | | Product Categories: | Organic Electronics and Photonics;Polyphenylenevinylene (PPV, CN-PPV) Monomers;Synthetic Tools and Reagents;electronic | | Mol File: | 146370-52-7.mol |  |
| | 2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene Chemical Properties |
| Boiling point | 421.6±40.0 °C(Predicted) | | density | 1.079±0.06 g/cm3(Predicted) | | Water Solubility | Insoluble in water. | | InChI | 1S/C17H26Cl2O2/c1-4-6-7-13(5-2)12-21-17-9-14(10-18)16(20-3)8-15(17)11-19/h8-9,13H,4-7,10-12H2,1-3H3 | | InChIKey | TXAVEVGYOGQVAN-UHFFFAOYSA-N | | SMILES | CCCCC(CC)COc1cc(CCl)c(OC)cc1CCl |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene Usage And Synthesis |
| Uses | Conducting polymer precursor. |
| | 2,5-Bis(chloromethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene Preparation Products And Raw materials |
|