| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Cyano-1-phenyl-2,2,2-trifluoroethanol Basic information |
| | 1-Cyano-1-phenyl-2,2,2-trifluoroethanol Chemical Properties |
| Melting point | 72-76 °C (lit.) | | form | solid | | InChI | 1S/C9H6F3NO/c10-9(11,12)8(14,6-13)7-4-2-1-3-5-7/h1-5,14H | | InChIKey | FFXHDJHFAYTIHJ-UHFFFAOYSA-N | | SMILES | OC(C#N)(c1ccccc1)C(F)(F)F |
| Hazard Codes | T | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Cyano-1-phenyl-2,2,2-trifluoroethanol Usage And Synthesis |
| | 1-Cyano-1-phenyl-2,2,2-trifluoroethanol Preparation Products And Raw materials |
|