Tenuazonic acid copper from alternaria a manufacturers
- Tenuazonic acid
-
- $2218.00
-
2026-07-27
- CAS:610-88-8
- Purity:
- Supply Ability: 10g
- Tenuazonic acid
-
- $2218.00
-
2025-07-19
- CAS:610-88-8
- Purity:
- Supply Ability: 10g
|
| | Tenuazonic acid copper from alternaria a Basic information |
| Product Name: | Tenuazonic acid copper from alternaria a | | Synonyms: | (S)-3-Acetyl-5-(S)-sec-butyltetramic acid;(S)-3-Acetyl-5-sec-butyl-4-hydroxy-3-pyrrolin-2-one;2h-pyrrol-2-one,3-acetyl-1,5-dihydro-4-hydroxy-5-(1-methylpropyl)-,(s-(r*,r;l-3-pyrrolin-2-on;tenuazonic acid copper from alternaria*alternata;TenuazonicacidfromAlternariasp;3-acetyl-5-sec-butyl-4-hydroxy-3-pyrrolin-2-one;tenuazonic acid copper salt from alternaria alternata | | CAS: | 610-88-8 | | MF: | C10H15NO3 | | MW: | 197.23 | | EINECS: | | | Product Categories: | Chiral Reagents;Inhibitors;Inhibitor | | Mol File: | 610-88-8.mol |  |
| | Tenuazonic acid copper from alternaria a Chemical Properties |
| Melting point | 74.5°C | | alpha | 20D -128° (c = 1.0 in methanol); -132 ± 2° (c = 0.5 in CHCl3) | | Boiling point | bp0.035 117° | | density | 1.1575 (rough estimate) | | refractive index | 1.5480 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.50±1.00(Predicted) | | color | Light yellow to brown | | BRN | 3589518 | | Stability: | Hygroscopic, Temperature Sensitive | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C10H15NO3/c1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h5,8,13H,4H2,1-3H3,(H,11,14)/t5-,8-/m0/s1 | | InChIKey | CEIZFXOZIQNICU-XNCJUZBTSA-N | | SMILES | CC[C@H](C)[C@@H]1NC(=O)C(C(C)=O)=C1O |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | UY7425000 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29337900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Tenuazonic acid copper from alternaria a Usage And Synthesis |
| Chemical Properties | Colorless solid | | Uses | Tenuazonic acid is potent tetramic acid mycotoxin produced by several fungal genera, notably Alternaria. Tenuazonic acid exhibits antitumour, antiviral and antibacterial activity. | | Uses | An alternaria mycotoxin, found in common edible crops. It inhibits protein synthesis in fibroblasts. |
| | Tenuazonic acid copper from alternaria a Preparation Products And Raw materials |
|