| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4 7-Dimethoxy-1-naphthaldehyde 97 Basic information |
| | 4 7-Dimethoxy-1-naphthaldehyde 97 Chemical Properties |
| Melting point | 79-83 °C (lit.) | | Boiling point | 391.9±22.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C13H12O3/c1-15-10-4-5-11-12(7-10)9(8-14)3-6-13(11)16-2/h3-8H,1-2H3 | | InChIKey | FFAODEUKHYBIKI-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(OC)c2ccc(OC)cc12 |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | 4 7-Dimethoxy-1-naphthaldehyde 97 Usage And Synthesis |
| | 4 7-Dimethoxy-1-naphthaldehyde 97 Preparation Products And Raw materials |
|