| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PERFLUOROTRIDECANOIC ACID 97 Basic information |
| Product Name: | PERFLUOROTRIDECANOIC ACID 97 | | Synonyms: | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-tricosafluorotridecanoic acid;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-Pentacosafluorotridecanoic acid;Perfluorotridecanoic acid 97%;Tridecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-pentacosafluoro-;Perfluorotridecanoic Acid (50μg/mL in Methanol)
DISCONTINUED. Please see P286700.;Perfluorotridecanoic acid 50 μg/mL in Methanol:Water;Perfluorotridecanoic acid, n-isomer (major);Perfluoro-n-tridecanoic acid in Methanol | | CAS: | 72629-94-8 | | MF: | C13HF25O2 | | MW: | 664.11 | | EINECS: | 276-745-2 | | Product Categories: | Building Blocks;C13 to C42+;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;C13 to C42+;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 72629-94-8.mol |  |
| | PERFLUOROTRIDECANOIC ACID 97 Chemical Properties |
| Melting point | 112-123 °C (lit.) | | Boiling point | 260.7±35.0 °C(Predicted) | | density | 1.773±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Ethanol: Slightly soluble | | form | A solid | | pka | 0.52±0.10(Predicted) | | InChI | 1S/C13HF25O2/c14-2(15,1(39)40)3(16,17)4(18,19)5(20,21)6(22,23)7(24,25)8(26,27)9(28,29)10(30,31)11(32,33)12(34,35)13(36,37)38/h(H,39,40) | | InChIKey | LVDGGZAZAYHXEY-UHFFFAOYSA-N | | SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Perfluorotridecanoic acid (72629-94-8) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Lact.
Repr. 1B
STOT RE 1 |
| | PERFLUOROTRIDECANOIC ACID 97 Usage And Synthesis |
| Uses | Perfluorotridecanoic Acid (Perfluorinated Compound (PFC)) is a perfluorinated alkyl acid (PFAA) and a possible organic pollutant. |
| | PERFLUOROTRIDECANOIC ACID 97 Preparation Products And Raw materials |
|