4-(4-FORMYLPHENOXY)BENZONITRILE 96 manufacturers
|
| | 4-(4-FORMYLPHENOXY)BENZONITRILE 96 Basic information |
| Product Name: | 4-(4-FORMYLPHENOXY)BENZONITRILE 96 | | Synonyms: | JR-8228, 4-(4-Formylphenoxy)benzonitrile, 97%;4-(4-FORMYLPHENOXY)BENZONITRILE 96;Benzonitrile, 4-(4-formylphenoxy)-;4-(4-formylphenoxy)benzenemethylnitrile | | CAS: | 90178-71-5 | | MF: | C14H9NO2 | | MW: | 223.23 | | EINECS: | | | Product Categories: | | | Mol File: | 90178-71-5.mol |  |
| | 4-(4-FORMYLPHENOXY)BENZONITRILE 96 Chemical Properties |
| Melting point | 88-93 °C | | Boiling point | 391.5±27.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C14H9NO2/c15-9-11-1-5-13(6-2-11)17-14-7-3-12(10-16)4-8-14/h1-8,10H | | InChIKey | PYODQZCRZBCXPW-UHFFFAOYSA-N | | SMILES | O=Cc1ccc(Oc2ccc(cc2)C#N)cc1 |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| | 4-(4-FORMYLPHENOXY)BENZONITRILE 96 Usage And Synthesis |
| | 4-(4-FORMYLPHENOXY)BENZONITRILE 96 Preparation Products And Raw materials |
|