|
|
| | BIFEPRUNOX MESYLATE Basic information |
| | BIFEPRUNOX MESYLATE Chemical Properties |
| Melting point | 257-259°C | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | ONWKHSGOYGLGPO-UHFFFAOYSA-N | | SMILES | O=C1OC2=C(N3CCN(CC4=CC=CC(C5=CC=CC=C5)=C4)CC3)C=CC=C2N1.CS(=O)(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | BIFEPRUNOX MESYLATE Usage And Synthesis |
| Chemical Properties | BIFEPRUNOX MESYLATE is Off-White Solid | | Uses | BIFEPRUNOX MESYLATE is used as an antipsychotic compound. Activates the serotonin 5-hydroxytryptamine (5-HT)1A receptor | | Biological Activity | Bifeprunox (DU-127,090) is an atypical antipsychotic. Bifeprunox is a dopamine D2 receptor (D2R) partial agonist th at exhibits 5-HT1A agonist properties. | | in vivo | Bifeprunox (0.001-2.5 mg/kg) reduces marble burying in mice[2].
Bifeprunox (4-250 μg/kg) influences nicotine-seeking behaviour in response to drug-associated stimuli in rats[3]. |
| | BIFEPRUNOX MESYLATE Preparation Products And Raw materials |
|