|
|
| | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP Basic information | | Uses |
| Product Name: | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP | | Synonyms: | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP;1,1'-[(1R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[1H-INDENE]-7,7'-DIYL]BIS[1,1-DIPHENYLPHOSPHINE];1,1'-[(1R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diyl]bis[1,1-diphenylphosphine],99%e.e.;(R)-(+)-7,7′-Bis(diphenylphosphino)-2,2′,3,3′-tetrahydro-1,1′-spirobiindene;Phosphine, 1,1'-[(1R)-2,2',3,3'-tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diyl]bis[1,1-diphenyl- (9CI);(R)-SDP,(R)-7,7′-bis(diphenylphosphino)-1,1′-spirobiindane;(R)-(+)-7,7''-Bis(diphenylphosphino)-2,2'',3,3''-tetrahydro-1,1''-spirobiindane;(R)-7,7'-Bis(diphenylphosphanyl)-2,2',3,3'-tetrahydro-1,1'-spirobi[indene | | CAS: | 917377-74-3 | | MF: | C41H34P2 | | MW: | 588.66 | | EINECS: | | | Product Categories: | BINAP Series;Chiral Phosphine;Chiral Spiro Ligand | | Mol File: | 917377-74-3.mol |  |
| | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP Chemical Properties |
| Melting point | 200-202°C | | alpha | +207° (c 0.5, CH2Cl2) | | Boiling point | 690.2±55.0 °C(Predicted) | | storage temp. | -20°C | | form | solid | | color | white | | Optical Rotation | [α]22/D +184°, c = 1 in chloroform | | Sensitive | air sensitive | | InChIKey | DKZNVWNOOLQCMJ-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC2=C1C1(C3=C(CC1)C=CC=C3P(C1=CC=CC=C1)C1=CC=CC=C1)CC2)(C1=CC=CC=C1)C1=CC=CC=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP Usage And Synthesis |
| Uses |
- Ligands used for the ruthenium-catalyzed hydrogenation of simple and cyclic ketones with high activity and enantioselectivity.
- Ligands used for palladium-catalyzed asymmetric allylic alkylations.
| | Chemical Properties | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP is White to light yellow solid | | reaction suitability | reagent type: ligand |
| | (R)-(+)-7,7'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE, MIN. 97% (R)-SDP Preparation Products And Raw materials |
|