| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (S)-(-)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobiindane Basic information | | Reaction |
| Product Name: | (S)-(-)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobiindane | | Synonyms: | (S)-7,7-BIS[DI(3,5-DIMETHYLPHENYL)PHOSPHINO]-1,1-SPIROBIINDANE;(S)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-1,1'-spirobiindane ,97%;(S)-()-7,7′-Bis[di(3,5-dimethylphenyl)phosphino]-2,2′,3,3′-tetrahydro-1,1′-spirobiindene;(S)–7,7′-Bis[di(3,5-dimethylphenyl)phosphino]-1,1′-spirobiindan;1,1'-[(1S)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[1H-INDENE]-7,7'-DIYL]BIS[1,1-BIS(3,5-DIMETHYLPHENYL)PHOSPHINE];1,1'-[(1S)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diyl]bis[1,1-bis(3,5-dimethylphenyl)phosphine],99%e.e.;(R)-7,7'-BIS[DI(3,5-DIMETHYLPHENYL)PHOSPHINO]-1,1'-SPIROBIINDANE;(R)-(+)-7,7'-BIS[DI(3,5-DIMETHYLPHENYL)PHOSPHINO]-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBIINDANE | | CAS: | 528521-89-3 | | MF: | C49H50P2 | | MW: | 700.87 | | EINECS: | | | Product Categories: | BINAP Series;Chiral Phosphine;Chiral Spiro Ligand | | Mol File: | 528521-89-3.mol | ![(S)-(-)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobiindane Structure](CAS/GIF/528521-89-3.gif) |
| | (S)-(-)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobiindane Chemical Properties |
| Melting point | >300°C | | Boiling point | 794.8±60.0 °C(Predicted) | | alpha | -83° (c 0.53, CH2Cl2) | | storage temp. | -20°C | | form | solid | | color | off-white to pale yellow | | Optical Rotation | [α]22/D 62.0°, c = 1 in chloroform | | Sensitive | air sensitive | | InChIKey | AZSBNBQMIMQOPG-UHFFFAOYSA-N | | SMILES | C12(CCC3C=CC=C(C1=3)P(C1=CC(C)=CC(C)=C1)C1=CC(C)=CC(C)=C1)CCC1C=CC=C(C2=1)P(C1C=C(C)C=C(C)C=1)C1C=C(C)C=C(C)C=1 | | CAS DataBase Reference | 528521-89-3 |
| WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | (S)-(-)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobiindane Usage And Synthesis |
| Reaction |
- Chiral ligands for ruthenium-catalyzed asymmetric hydrogenation of simple ketones.
- Chiral ligands for ruthenium-catalyzed asymmetric hydrogenation of racemic α-aryl cyclic ketones via dynamic kinetic resolution.
| | Chemical Properties | Colorless oil | | reaction suitability | reagent type: ligand |
| | (S)-(-)-7,7'-Bis[di(3,5-dimethylphenyl)phosphino]-2,2',3,3'-tetrahydro-1,1'-spirobiindane Preparation Products And Raw materials |
|