| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | ISOVELLERAL Basic information |
| Product Name: | ISOVELLERAL | | Synonyms: | (1aβ,3aα,6aα,6bβ)-3a,4,5,6,6a,6b-Hexahydro-5,5,6b-trimethylcycloprop[e]indene-1a,2(1H)-dicarbaldehyde;C09692;ISOVELLERAL;(1as-(1a-alpha,3a-beta,6a-beta,6b-alpha))-rimethyl;cycloprop(e)indene-1a,2(1h)-dicarboxaldehyde,3a,4,5,6,6a,6b-hexahydro-5,5,6b-t;Cycloprop[e]indene-1a,2(1H)-dicarboxaldehyde, 3a,4,5,6,6a,6b-hexahydro-5,5,6b-trimethyl-, (1aS,3aS,6aS,6bR)- | | CAS: | 37841-91-1 | | MF: | C15H20O2 | | MW: | 232.32 | | EINECS: | | | Product Categories: | | | Mol File: | 37841-91-1.mol |  |
| | ISOVELLERAL Chemical Properties |
| Melting point | 104.5-105 °C | | Boiling point | 322.8±35.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | H2O: insoluble | | form | solid | | color | white | | Water Solubility | H2O: insoluble
organic solvents: soluble | | InChI | 1S/C15H20O2/c1-13(2)5-10-4-11(7-16)15(9-17)8-14(15,3)12(10)6-13/h4,7,9-10,12H,5-6,8H2,1-3H3/t10-,12+,14-,15-/m1/s1 | | InChIKey | PJAAESPGJOSQGZ-DZGBDDFRSA-N | | SMILES | [H]C(=O)C1=C[C@]2([H])CC(C)(C)C[C@]2([H])[C@]3(C)C[C@@]13C([H])=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | GZ2245000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ISOVELLERAL Usage And Synthesis |
| Uses | Isovelleral is an irritant fungal terpenoid that inhibits the TRPV1 channel. | | Definition | ChEBI: Isovelleral is an aldehyde. | | Biological Activity | Vanilloid receptor agonist. |
| | ISOVELLERAL Preparation Products And Raw materials |
|