7-Aminoclonazepam manufacturers
- 7-AMINOCLONAZEPAM
-
- $1.00
-
2026-08-07
- CAS:4959-17-5
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 300KG
|
| | 7-Aminoclonazepam Basic information |
| | 7-Aminoclonazepam Chemical Properties |
| Melting point | 226-228°C | | Boiling point | 523.5±50.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | Fp | 2℃ | | storage temp. | Controlled Substance, -20°C Freezer | | pka | 12.15±0.70(Predicted) | | form | powder | | InChI | 1S/C15H12ClN3O/c16-12-4-2-1-3-10(12)15-11-7-9(17)5-6-13(11)19-14(20)8-18-15/h1-7H,8,17H2,(H,19,20) | | InChIKey | HEFRPWRJTGLSSV-UHFFFAOYSA-N | | SMILES | Clc1c(cccc1)C2=NCC(=O)Nc3c2cc(cc3)N |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-36/37-26 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 7-Aminoclonazepam Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | The major metabolite of Clonazepam (C587080). | | Definition | ChEBI: 7-Aminoclonazepam is a benzodiazepine. |
| | 7-Aminoclonazepam Preparation Products And Raw materials |
|