- 2-METHYL-5-PROPIONYL-FURAN
-
- $200.00 / 1KG
-
2025-09-25
- CAS:10599-69-6
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-METHYL-5-PROPIONYL-FURAN Basic information |
| Product Name: | 2-METHYL-5-PROPIONYL-FURAN | | Synonyms: | 1-(5-Methyl-2-furyl)-1-propanone;1-Propanone, 1-(5-methyl-2-furanyl)-;1-Propanone, 1-(5-methyl-2-furyl)-;carbonic acid 2-(2-ethoxycarbonyloxyethoxy)ethyl ethyl ester;5-Methyl-2-propionylfuran;5-Methyl-5-propionylfuran;Furan, 2-methyl-5-propionyl;1-(5-methyl-2-furyl)propan-1-one | | CAS: | 10599-69-6 | | MF: | C8H10O2 | | MW: | 138.16 | | EINECS: | 234-215-8 | | Product Categories: | Pharmaceutical intermediates | | Mol File: | 10599-69-6.mol |  |
| | 2-METHYL-5-PROPIONYL-FURAN Chemical Properties |
| Boiling point | 72°C/5mmHg(lit.) | | density | 1.0742 (rough estimate) | | refractive index | 1.5037-1.5057 | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | form | Liquid | | color | Clear yellow | | λmax | 282nm(EtOH)(lit.) | | InChI | InChI=1S/C8H10O2/c1-3-7(9)8-5-4-6(2)10-8/h4-5H,3H2,1-2H3 | | InChIKey | BXLPZYAVKVFXEO-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C)O1)(=O)CC | | LogP | 0.865 (est) |
| Safety Statements | 24/25 | | HS Code | 29321900 |
| Provider | Language |
|
ACROS
| English |
| | 2-METHYL-5-PROPIONYL-FURAN Usage And Synthesis |
| Chemical Properties | Clear yellow liquid | | Definition | ChEBI: 2-methyl-5-propionylfuran is a member of the class of furans that is furan substituted by propionyl and methyl groups at positions 2 and 5, respectively. It is a flavouring agent found in sesame seed oil and coffee. It has a role as a flavouring agent, a plant metabolite and a human metabolite. It is an aromatic ketone and a member of furans. |
| | 2-METHYL-5-PROPIONYL-FURAN Preparation Products And Raw materials |
|